C13H10F3N3O3S — CID 155256709
ethyl 5-[[3-(trifluoromethyl)benzoyl]amino]thiadiazole-4-carboxylate (PubChem CID 155256709) has the molecular formula C13H10F3N3O3S and a molecular weight of 345.30 g/mol. Its IUPAC name is ethyl 5-[[3-(trifluoromethyl)benzoyl]amino]thiadiazole-4-carboxylate.
| Compound Name | ethyl 5-[[3-(trifluoromethyl)benzoyl]amino]thiadiazole-4-carboxylate |
|---|---|
| PubChem CID | 155256709 |
| Molecular Formula | C13H10F3N3O3S |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | ethyl 5-[[3-(trifluoromethyl)benzoyl]amino]thiadiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnsc1NC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H10F3N3O3S/c1-2-22-12(21)9-11(23-19-18-9)17-10(20)7-4-3-5-8(6-7)13(14,15)16/h3-6H,2H2,1H3,(H,17,20) |
| InChIKey | JJGISXUPEXRGDM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |