C18H22N4O5S2 — CID 55642731
ethyl 5-[[4-(azepan-1-ylsulfonyl)benzoyl]amino]thiadiazole-4-carboxylate (PubChem CID 55642731) has the molecular formula C18H22N4O5S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is ethyl 5-[[4-(azepan-1-ylsulfonyl)benzoyl]amino]thiadiazole-4-carboxylate.
| Compound Name | ethyl 5-[[4-(azepan-1-ylsulfonyl)benzoyl]amino]thiadiazole-4-carboxylate |
|---|---|
| PubChem CID | 55642731 |
| Molecular Formula | C18H22N4O5S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | ethyl 5-[[4-(azepan-1-ylsulfonyl)benzoyl]amino]thiadiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnsc1NC(=O)c1ccc(S(=O)(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C18H22N4O5S2/c1-2-27-18(24)15-17(28-21-20-15)19-16(23)13-7-9-14(10-8-13)29(25,26)22-11-5-3-4-6-12-22/h7-10H,2-6,11-12H2,1H3,(H,19,23) |
| InChIKey | QASIHMNMOLZFGF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |