C16H17FN4O5S2 — CID 55671146
ethyl 5-[(4-fluoro-3-pyrrolidin-1-ylsulfonylbenzoyl)amino]thiadiazole-4-carboxylate (PubChem CID 55671146) has the molecular formula C16H17FN4O5S2 and a molecular weight of 428.47 g/mol. Its IUPAC name is ethyl 5-[(4-fluoro-3-pyrrolidin-1-ylsulfonylbenzoyl)amino]thiadiazole-4-carboxylate.
| Compound Name | ethyl 5-[(4-fluoro-3-pyrrolidin-1-ylsulfonylbenzoyl)amino]thiadiazole-4-carboxylate |
|---|---|
| PubChem CID | 55671146 |
| Molecular Formula | C16H17FN4O5S2 |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | ethyl 5-[(4-fluoro-3-pyrrolidin-1-ylsulfonylbenzoyl)amino]thiadiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnsc1NC(=O)c1ccc(F)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C16H17FN4O5S2/c1-2-26-16(23)13-15(27-20-19-13)18-14(22)10-5-6-11(17)12(9-10)28(24,25)21-7-3-4-8-21/h5-6,9H,2-4,7-8H2,1H3,(H,18,22) |
| InChIKey | NZOAWUKNOPOTFB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |