C21H23ClFN3O4S — CID 55896344
N-[2-chloro-5-(propan-2-ylcarbamoyl)phenyl]-4-fluoro-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 55896344) has the molecular formula C21H23ClFN3O4S and a molecular weight of 467.95 g/mol. Its IUPAC name is N-[2-chloro-5-(propan-2-ylcarbamoyl)phenyl]-4-fluoro-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[2-chloro-5-(propan-2-ylcarbamoyl)phenyl]-4-fluoro-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55896344 |
| Molecular Formula | C21H23ClFN3O4S |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | N-[2-chloro-5-(propan-2-ylcarbamoyl)phenyl]-4-fluoro-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CC(C)NC(=O)c1ccc(Cl)c(NC(=O)c2ccc(F)c(S(=O)(=O)N3CCCC3)c2)c1 |
| InChI | InChI=1S/C21H23ClFN3O4S/c1-13(2)24-20(27)14-5-7-16(22)18(11-14)25-21(28)15-6-8-17(23)19(12-15)31(29,30)26-9-3-4-10-26/h5-8,11-13H,3-4,9-10H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | JBJLFWUODMNVBI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |