C18H25FN2O5S — CID 55942900
methyl (2S)-2-[(4-fluoro-3-piperidin-1-ylsulfonylbenzoyl)amino]-3-methylbutanoate (PubChem CID 55942900) has the molecular formula C18H25FN2O5S and a molecular weight of 400.47 g/mol. Its IUPAC name is methyl (2S)-2-[(4-fluoro-3-piperidin-1-ylsulfonylbenzoyl)amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[(4-fluoro-3-piperidin-1-ylsulfonylbenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55942900 |
| Molecular Formula | C18H25FN2O5S |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | methyl (2S)-2-[(4-fluoro-3-piperidin-1-ylsulfonylbenzoyl)amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)c1ccc(F)c(S(=O)(=O)N2CCCCC2)c1)C(C)C |
| InChI | InChI=1S/C18H25FN2O5S/c1-12(2)16(18(23)26-3)20-17(22)13-7-8-14(19)15(11-13)27(24,25)21-9-5-4-6-10-21/h7-8,11-12,16H,4-6,9-10H2,1-3H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | IZXKUZCXVXREOC-INIZCTEOSA-N |
| XLogP | 1.93 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |