C20H20F4N2O3S — CID 55794746
4-fluoro-3-piperidin-1-ylsulfonyl-N-(2,2,2-trifluoro-1-phenylethyl)benzamide (PubChem CID 55794746) has the molecular formula C20H20F4N2O3S and a molecular weight of 444.45 g/mol. Its IUPAC name is 4-fluoro-3-piperidin-1-ylsulfonyl-N-(2,2,2-trifluoro-1-phenylethyl)benzamide.
| Compound Name | 4-fluoro-3-piperidin-1-ylsulfonyl-N-(2,2,2-trifluoro-1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 55794746 |
| Molecular Formula | C20H20F4N2O3S |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 4-fluoro-3-piperidin-1-ylsulfonyl-N-(2,2,2-trifluoro-1-phenylethyl)benzamide |
| SMILES | O=C(NC(c1ccccc1)C(F)(F)F)c1ccc(F)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C20H20F4N2O3S/c21-16-10-9-15(13-17(16)30(28,29)26-11-5-2-6-12-26)19(27)25-18(20(22,23)24)14-7-3-1-4-8-14/h1,3-4,7-10,13,18H,2,5-6,11-12H2,(H,25,27) |
| InChIKey | IWPKISOGANARDK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |