C24H29FN2O4S — CID 55690040
N-[cyclohexyl(phenyl)methyl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 55690040) has the molecular formula C24H29FN2O4S and a molecular weight of 460.57 g/mol. Its IUPAC name is N-[cyclohexyl(phenyl)methyl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[cyclohexyl(phenyl)methyl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55690040 |
| Molecular Formula | C24H29FN2O4S |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | N-[cyclohexyl(phenyl)methyl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(NC(c1ccccc1)C1CCCCC1)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C24H29FN2O4S/c25-21-12-11-20(17-22(21)32(29,30)27-13-15-31-16-14-27)24(28)26-23(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1,3-4,7-8,11-12,17,19,23H,2,5-6,9-10,13-16H2,(H,26,28) |
| InChIKey | POGFDBHGBWQRKO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |