C25H31FN2O3S — CID 55690179
N-[cyclohexyl(phenyl)methyl]-1-(2-fluorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 55690179) has the molecular formula C25H31FN2O3S and a molecular weight of 458.60 g/mol. Its IUPAC name is N-[cyclohexyl(phenyl)methyl]-1-(2-fluorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[cyclohexyl(phenyl)methyl]-1-(2-fluorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55690179 |
| Molecular Formula | C25H31FN2O3S |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | N-[cyclohexyl(phenyl)methyl]-1-(2-fluorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NC(c1ccccc1)C1CCCCC1)C1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C25H31FN2O3S/c26-22-13-7-8-14-23(22)32(30,31)28-17-15-21(16-18-28)25(29)27-24(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1,3-4,7-10,13-14,20-21,24H,2,5-6,11-12,15-18H2,(H,27,29) |
| InChIKey | DLCFRRYRAMGUPR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |