C21H23FN2O5S — CID 26864762
methyl 3-[(4-fluoro-3-piperidin-1-ylsulfonylbenzoyl)amino]-4-methylbenzoate (PubChem CID 26864762) has the molecular formula C21H23FN2O5S and a molecular weight of 434.49 g/mol. Its IUPAC name is methyl 3-[(4-fluoro-3-piperidin-1-ylsulfonylbenzoyl)amino]-4-methylbenzoate.
| Compound Name | methyl 3-[(4-fluoro-3-piperidin-1-ylsulfonylbenzoyl)amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 26864762 |
| Molecular Formula | C21H23FN2O5S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | methyl 3-[(4-fluoro-3-piperidin-1-ylsulfonylbenzoyl)amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)c2ccc(F)c(S(=O)(=O)N3CCCCC3)c2)c1 |
| InChI | InChI=1S/C21H23FN2O5S/c1-14-6-7-16(21(26)29-2)12-18(14)23-20(25)15-8-9-17(22)19(13-15)30(27,28)24-10-4-3-5-11-24/h6-9,12-13H,3-5,10-11H2,1-2H3,(H,23,25) |
| InChIKey | DXDYYVQTJWXUBA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |