C24H18F3N3O3 — CID 46235932
ethyl 6-[3-[[3-(trifluoromethyl)benzoyl]amino]phenyl]-1H-indazole-3-carboxylate (PubChem CID 46235932) has the molecular formula C24H18F3N3O3 and a molecular weight of 453.42 g/mol. Its IUPAC name is ethyl 6-[3-[[3-(trifluoromethyl)benzoyl]amino]phenyl]-1H-indazole-3-carboxylate.
| Compound Name | ethyl 6-[3-[[3-(trifluoromethyl)benzoyl]amino]phenyl]-1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 46235932 |
| Molecular Formula | C24H18F3N3O3 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | ethyl 6-[3-[[3-(trifluoromethyl)benzoyl]amino]phenyl]-1H-indazole-3-carboxylate |
| SMILES | CCOC(=O)c1n[nH]c2cc(-c3cccc(NC(=O)c4cccc(C(F)(F)F)c4)c3)ccc12 |
| InChI | InChI=1S/C24H18F3N3O3/c1-2-33-23(32)21-19-10-9-15(13-20(19)29-30-21)14-5-4-8-18(12-14)28-22(31)16-6-3-7-17(11-16)24(25,26)27/h3-13H,2H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | MXWDASTWMGSSKE-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |