C16H15N3O2 — CID 46235778
ethyl 6-(3-aminophenyl)-1H-indazole-3-carboxylate (PubChem CID 46235778) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is ethyl 6-(3-aminophenyl)-1H-indazole-3-carboxylate.
| Compound Name | ethyl 6-(3-aminophenyl)-1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 46235778 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | ethyl 6-(3-aminophenyl)-1H-indazole-3-carboxylate |
| SMILES | CCOC(=O)c1n[nH]c2cc(-c3cccc(N)c3)ccc12 |
| InChI | InChI=1S/C16H15N3O2/c1-2-21-16(20)15-13-7-6-11(9-14(13)18-19-15)10-4-3-5-12(17)8-10/h3-9H,2,17H2,1H3,(H,18,19) |
| InChIKey | RMULHZIERLZKBH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|