C17H17F3N2O3S — CID 10810174
N-[2-amino-5-[3-(trifluoromethyl)benzoyl]phenyl]propane-2-sulfonamide (PubChem CID 10810174) has the molecular formula C17H17F3N2O3S and a molecular weight of 386.40 g/mol. Its IUPAC name is N-[2-amino-5-[3-(trifluoromethyl)benzoyl]phenyl]propane-2-sulfonamide.
| Compound Name | N-[2-amino-5-[3-(trifluoromethyl)benzoyl]phenyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 10810174 |
| Molecular Formula | C17H17F3N2O3S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N-[2-amino-5-[3-(trifluoromethyl)benzoyl]phenyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)Nc1cc(C(=O)c2cccc(C(F)(F)F)c2)ccc1N |
| InChI | InChI=1S/C17H17F3N2O3S/c1-10(2)26(24,25)22-15-9-12(6-7-14(15)21)16(23)11-4-3-5-13(8-11)17(18,19)20/h3-10,22H,21H2,1-2H3 |
| InChIKey | MQBOCZIZXSOOBF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|