C14H17FN4O4S — CID 87927690
N-(cyanomethyl)-2-[(2-fluorophenyl)methylcarbamoylamino]-3-methylsulfonylpropanamide (PubChem CID 87927690) has the molecular formula C14H17FN4O4S and a molecular weight of 356.38 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[(2-fluorophenyl)methylcarbamoylamino]-3-methylsulfonylpropanamide.
| Compound Name | N-(cyanomethyl)-2-[(2-fluorophenyl)methylcarbamoylamino]-3-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 87927690 |
| Molecular Formula | C14H17FN4O4S |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-(cyanomethyl)-2-[(2-fluorophenyl)methylcarbamoylamino]-3-methylsulfonylpropanamide |
| SMILES | CS(=O)(=O)CC(NC(=O)NCc1ccccc1F)C(=O)NCC#N |
| InChI | InChI=1S/C14H17FN4O4S/c1-24(22,23)9-12(13(20)17-7-6-16)19-14(21)18-8-10-4-2-3-5-11(10)15/h2-5,12H,7-9H2,1H3,(H,17,20)(H2,18,19,21) |
| InChIKey | MPPKIRMJPLYIOR-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 128.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|