C12H18N2O3S — CID 53279666
4-[methyl(methylsulfonyl)amino]-N-propylbenzamide (PubChem CID 53279666) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 4-[methyl(methylsulfonyl)amino]-N-propylbenzamide.
| Compound Name | 4-[methyl(methylsulfonyl)amino]-N-propylbenzamide |
|---|---|
| PubChem CID | 53279666 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-[methyl(methylsulfonyl)amino]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccc(N(C)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H18N2O3S/c1-4-9-13-12(15)10-5-7-11(8-6-10)14(2)18(3,16)17/h5-8H,4,9H2,1-3H3,(H,13,15) |
| InChIKey | OQWTUGJKIGNFCC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |