C15H24N2O3S — CID 100787251
2-[4-[methyl(methylsulfonyl)amino]phenyl]-N-pentylacetamide (PubChem CID 100787251) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 2-[4-[methyl(methylsulfonyl)amino]phenyl]-N-pentylacetamide.
| Compound Name | 2-[4-[methyl(methylsulfonyl)amino]phenyl]-N-pentylacetamide |
|---|---|
| PubChem CID | 100787251 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-[4-[methyl(methylsulfonyl)amino]phenyl]-N-pentylacetamide |
| SMILES | CCCCCNC(=O)Cc1ccc(N(C)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H24N2O3S/c1-4-5-6-11-16-15(18)12-13-7-9-14(10-8-13)17(2)21(3,19)20/h7-10H,4-6,11-12H2,1-3H3,(H,16,18) |
| InChIKey | UVMLRQHAPNJXOC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|