C31H29N3O5S3 — CID 143761162
4-[[3-hydroxy-6,8-bis(hydroxysulfanyl)pyren-1-yl]sulfanyl-methylamino]-N-[3-(2-methylprop-2-enoylamino)propyl]benzamide (PubChem CID 143761162) has the molecular formula C31H29N3O5S3 and a molecular weight of 619.79 g/mol. Its IUPAC name is 4-[[3-hydroxy-6,8-bis(hydroxysulfanyl)pyren-1-yl]sulfanyl-methylamino]-N-[3-(2-methylprop-2-enoylamino)propyl]benzamide.
| Compound Name | 4-[[3-hydroxy-6,8-bis(hydroxysulfanyl)pyren-1-yl]sulfanyl-methylamino]-N-[3-(2-methylprop-2-enoylamino)propyl]benzamide |
|---|---|
| PubChem CID | 143761162 |
| Molecular Formula | C31H29N3O5S3 |
| Molecular Weight | 619.79 g/mol |
| Exact Mass | 619.13 |
| IUPAC Name | 4-[[3-hydroxy-6,8-bis(hydroxysulfanyl)pyren-1-yl]sulfanyl-methylamino]-N-[3-(2-methylprop-2-enoylamino)propyl]benzamide |
| SMILES | C=C(C)C(=O)NCCCNC(=O)c1ccc(N(C)Sc2cc(O)c3ccc4c(SO)cc(SO)c5ccc2c3c45)cc1 |
| InChI | InChI=1S/C31H29N3O5S3/c1-17(2)30(36)32-13-4-14-33-31(37)18-5-7-19(8-6-18)34(3)40-25-15-24(35)20-9-10-22-26(41-38)16-27(42-39)23-12-11-21(25)28(20)29(22)23/h5-12,15-16,35,38-39H,1,4,13-14H2,2-3H3,(H,32,36)(H,33,37) |
| InChIKey | UEGDTHCOJCYWLU-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.79 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|