C19H21ClN2O3 — CID 21350487
4-chloro-1-hydroxy-5-methyl-N-[3-(2-methylprop-2-enoylamino)propyl]naphthalene-2-carboxamide (PubChem CID 21350487) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is 4-chloro-1-hydroxy-5-methyl-N-[3-(2-methylprop-2-enoylamino)propyl]naphthalene-2-carboxamide.
| Compound Name | 4-chloro-1-hydroxy-5-methyl-N-[3-(2-methylprop-2-enoylamino)propyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 21350487 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 4-chloro-1-hydroxy-5-methyl-N-[3-(2-methylprop-2-enoylamino)propyl]naphthalene-2-carboxamide |
| SMILES | C=C(C)C(=O)NCCCNC(=O)c1cc(Cl)c2c(C)cccc2c1O |
| InChI | InChI=1S/C19H21ClN2O3/c1-11(2)18(24)21-8-5-9-22-19(25)14-10-15(20)16-12(3)6-4-7-13(16)17(14)23/h4,6-7,10,23H,1,5,8-9H2,2-3H3,(H,21,24)(H,22,25) |
| InChIKey | KYCNRLJAAYUFQQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|