C19H18ClFN2O — CID 44624444
3-chloro-N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]-2-fluorobenzamide (PubChem CID 44624444) has the molecular formula C19H18ClFN2O and a molecular weight of 344.82 g/mol. Its IUPAC name is 3-chloro-N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]-2-fluorobenzamide.
| Compound Name | 3-chloro-N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 44624444 |
| Molecular Formula | C19H18ClFN2O |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 3-chloro-N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]-2-fluorobenzamide |
| SMILES | Cc1[nH]c2c(C)cccc2c1CCNC(=O)c1cccc(Cl)c1F |
| InChI | InChI=1S/C19H18ClFN2O/c1-11-5-3-6-14-13(12(2)23-18(11)14)9-10-22-19(24)15-7-4-8-16(20)17(15)21/h3-8,23H,9-10H2,1-2H3,(H,22,24) |
| InChIKey | SVVRTKUYXSVUHN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|