C24H25N3O — CID 143932583
N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]-6-phenyl-1,2-dihydropyridine-5-carboxamide (PubChem CID 143932583) has the molecular formula C24H25N3O and a molecular weight of 371.48 g/mol. Its IUPAC name is N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]-6-phenyl-1,2-dihydropyridine-5-carboxamide.
| Compound Name | N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]-6-phenyl-1,2-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 143932583 |
| Molecular Formula | C24H25N3O |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]-6-phenyl-1,2-dihydropyridine-5-carboxamide |
| SMILES | Cc1[nH]c2c(C)cccc2c1CCNC(=O)C1=C(c2ccccc2)NCC=C1 |
| InChI | InChI=1S/C24H25N3O/c1-16-8-6-11-20-19(17(2)27-22(16)20)13-15-26-24(28)21-12-7-14-25-23(21)18-9-4-3-5-10-18/h3-12,25,27H,13-15H2,1-2H3,(H,26,28) |
| InChIKey | JHOYBSNWFBCCQS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|