C16H21ClN2O2 — CID 102125235
tert-butyl N-[2-(7-chloro-2-methyl-1H-indol-3-yl)ethyl]carbamate (PubChem CID 102125235) has the molecular formula C16H21ClN2O2 and a molecular weight of 308.81 g/mol. Its IUPAC name is tert-butyl N-[2-(7-chloro-2-methyl-1H-indol-3-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(7-chloro-2-methyl-1H-indol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 102125235 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | tert-butyl N-[2-(7-chloro-2-methyl-1H-indol-3-yl)ethyl]carbamate |
| SMILES | Cc1[nH]c2c(Cl)cccc2c1CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21ClN2O2/c1-10-11(8-9-18-15(20)21-16(2,3)4)12-6-5-7-13(17)14(12)19-10/h5-7,19H,8-9H2,1-4H3,(H,18,20) |
| InChIKey | PGTZMXLECAVNPN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|