C20H18ClN3O3 — CID 68621490
(2-methyl-1,3-benzoxazol-7-yl) N-[2-(7-chloro-2-methyl-1H-indol-3-yl)ethyl]carbamate (PubChem CID 68621490) has the molecular formula C20H18ClN3O3 and a molecular weight of 383.84 g/mol. Its IUPAC name is (2-methyl-1,3-benzoxazol-7-yl) N-[2-(7-chloro-2-methyl-1H-indol-3-yl)ethyl]carbamate.
| Compound Name | (2-methyl-1,3-benzoxazol-7-yl) N-[2-(7-chloro-2-methyl-1H-indol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 68621490 |
| Molecular Formula | C20H18ClN3O3 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | (2-methyl-1,3-benzoxazol-7-yl) N-[2-(7-chloro-2-methyl-1H-indol-3-yl)ethyl]carbamate |
| SMILES | Cc1nc2cccc(OC(=O)NCCc3c(C)[nH]c4c(Cl)cccc34)c2o1 |
| InChI | InChI=1S/C20H18ClN3O3/c1-11-13(14-5-3-6-15(21)18(14)23-11)9-10-22-20(25)27-17-8-4-7-16-19(17)26-12(2)24-16/h3-8,23H,9-10H2,1-2H3,(H,22,25) |
| InChIKey | MSYDCCQZXLPMTQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|