C18H20N2O3 — CID 68572367
(2,5-dimethylfuran-3-yl) N-[2-(2-methyl-1H-indol-3-yl)ethyl]carbamate (PubChem CID 68572367) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is (2,5-dimethylfuran-3-yl) N-[2-(2-methyl-1H-indol-3-yl)ethyl]carbamate.
| Compound Name | (2,5-dimethylfuran-3-yl) N-[2-(2-methyl-1H-indol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 68572367 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (2,5-dimethylfuran-3-yl) N-[2-(2-methyl-1H-indol-3-yl)ethyl]carbamate |
| SMILES | Cc1cc(OC(=O)NCCc2c(C)[nH]c3ccccc23)c(C)o1 |
| InChI | InChI=1S/C18H20N2O3/c1-11-10-17(13(3)22-11)23-18(21)19-9-8-14-12(2)20-16-7-5-4-6-15(14)16/h4-7,10,20H,8-9H2,1-3H3,(H,19,21) |
| InChIKey | JYBZRVFKLDCBLV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|