C16H17N3O2 — CID 112529696
5-methyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,3-oxazole-2-carboxamide (PubChem CID 112529696) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 5-methyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,3-oxazole-2-carboxamide.
| Compound Name | 5-methyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 112529696 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 5-methyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,3-oxazole-2-carboxamide |
| SMILES | Cc1cnc(C(=O)NCCc2c(C)[nH]c3ccccc23)o1 |
| InChI | InChI=1S/C16H17N3O2/c1-10-9-18-16(21-10)15(20)17-8-7-12-11(2)19-14-6-4-3-5-13(12)14/h3-6,9,19H,7-8H2,1-2H3,(H,17,20) |
| InChIKey | LWLSAAUXJKEATK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|