C16H18N4O2 — CID 110795628
N-[2-(2-methyl-1H-indol-3-yl)ethyl]-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide (PubChem CID 110795628) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is N-[2-(2-methyl-1H-indol-3-yl)ethyl]-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide.
| Compound Name | N-[2-(2-methyl-1H-indol-3-yl)ethyl]-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 110795628 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-[2-(2-methyl-1H-indol-3-yl)ethyl]-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1CCNC(=O)C1=NNC(=O)CC1 |
| InChI | InChI=1S/C16H18N4O2/c1-10-11(12-4-2-3-5-13(12)18-10)8-9-17-16(22)14-6-7-15(21)20-19-14/h2-5,18H,6-9H2,1H3,(H,17,22)(H,20,21) |
| InChIKey | ZXFZNDRUAJRQKZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|