C17H19N3O3 — CID 68622126
(3,5-dimethyl-1,2-oxazol-4-yl) N-[2-(2-methyl-1H-indol-3-yl)ethyl]carbamate (PubChem CID 68622126) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl) N-[2-(2-methyl-1H-indol-3-yl)ethyl]carbamate.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl) N-[2-(2-methyl-1H-indol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 68622126 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl) N-[2-(2-methyl-1H-indol-3-yl)ethyl]carbamate |
| SMILES | Cc1noc(C)c1OC(=O)NCCc1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C17H19N3O3/c1-10-13(14-6-4-5-7-15(14)19-10)8-9-18-17(21)22-16-11(2)20-23-12(16)3/h4-7,19H,8-9H2,1-3H3,(H,18,21) |
| InChIKey | OSDLQVFIVQVLSM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|