C20H17BrClN3O — CID 59173231
N-[2-(7-bromo-2-methyl-1H-indol-3-yl)ethyl]-5-chloro-1H-indole-2-carboxamide (PubChem CID 59173231) has the molecular formula C20H17BrClN3O and a molecular weight of 430.73 g/mol. Its IUPAC name is N-[2-(7-bromo-2-methyl-1H-indol-3-yl)ethyl]-5-chloro-1H-indole-2-carboxamide.
| Compound Name | N-[2-(7-bromo-2-methyl-1H-indol-3-yl)ethyl]-5-chloro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 59173231 |
| Molecular Formula | C20H17BrClN3O |
| Molecular Weight | 430.73 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | N-[2-(7-bromo-2-methyl-1H-indol-3-yl)ethyl]-5-chloro-1H-indole-2-carboxamide |
| SMILES | Cc1[nH]c2c(Br)cccc2c1CCNC(=O)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C20H17BrClN3O/c1-11-14(15-3-2-4-16(21)19(15)24-11)7-8-23-20(26)18-10-12-9-13(22)5-6-17(12)25-18/h2-6,9-10,24-25H,7-8H2,1H3,(H,23,26) |
| InChIKey | GMRWOLZLGUOWOX-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.73 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|