C22H20Cl2N2O — CID 91516728
1-(5-chloro-1H-indol-2-yl)-5-(7-chloro-2-methyl-1H-indol-3-yl)pentan-1-one (PubChem CID 91516728) has the molecular formula C22H20Cl2N2O and a molecular weight of 399.32 g/mol. Its IUPAC name is 1-(5-chloro-1H-indol-2-yl)-5-(7-chloro-2-methyl-1H-indol-3-yl)pentan-1-one.
| Compound Name | 1-(5-chloro-1H-indol-2-yl)-5-(7-chloro-2-methyl-1H-indol-3-yl)pentan-1-one |
|---|---|
| PubChem CID | 91516728 |
| Molecular Formula | C22H20Cl2N2O |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 1-(5-chloro-1H-indol-2-yl)-5-(7-chloro-2-methyl-1H-indol-3-yl)pentan-1-one |
| SMILES | Cc1[nH]c2c(Cl)cccc2c1CCCCC(=O)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C22H20Cl2N2O/c1-13-16(17-6-4-7-18(24)22(17)25-13)5-2-3-8-21(27)20-12-14-11-15(23)9-10-19(14)26-20/h4,6-7,9-12,25-26H,2-3,5,8H2,1H3 |
| InChIKey | ILMRGTCNFVSFET-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|