C24H20ClN3O2 — CID 46579208
[4-(5-chloro-1H-indole-2-carbonyl)piperazin-1-yl]-naphthalen-1-ylmethanone (PubChem CID 46579208) has the molecular formula C24H20ClN3O2 and a molecular weight of 417.90 g/mol. Its IUPAC name is [4-(5-chloro-1H-indole-2-carbonyl)piperazin-1-yl]-naphthalen-1-ylmethanone.
| Compound Name | [4-(5-chloro-1H-indole-2-carbonyl)piperazin-1-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 46579208 |
| Molecular Formula | C24H20ClN3O2 |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [4-(5-chloro-1H-indole-2-carbonyl)piperazin-1-yl]-naphthalen-1-ylmethanone |
| SMILES | O=C(c1cc2cc(Cl)ccc2[nH]1)N1CCN(C(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C24H20ClN3O2/c25-18-8-9-21-17(14-18)15-22(26-21)24(30)28-12-10-27(11-13-28)23(29)20-7-3-5-16-4-1-2-6-19(16)20/h1-9,14-15,26H,10-13H2 |
| InChIKey | MELVSCWKCPLXER-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |