C22H20Cl2N4O2 — CID 131965590
(Z)-2-amino-1-[4-(5-chloro-1H-indole-2-carbonyl)piperazin-1-yl]-3-(3-chlorophenyl)prop-2-en-1-one (PubChem CID 131965590) has the molecular formula C22H20Cl2N4O2 and a molecular weight of 443.33 g/mol. Its IUPAC name is (Z)-2-amino-1-[4-(5-chloro-1H-indole-2-carbonyl)piperazin-1-yl]-3-(3-chlorophenyl)prop-2-en-1-one.
| Compound Name | (Z)-2-amino-1-[4-(5-chloro-1H-indole-2-carbonyl)piperazin-1-yl]-3-(3-chlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 131965590 |
| Molecular Formula | C22H20Cl2N4O2 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | (Z)-2-amino-1-[4-(5-chloro-1H-indole-2-carbonyl)piperazin-1-yl]-3-(3-chlorophenyl)prop-2-en-1-one |
| SMILES | N/C(=C\c1cccc(Cl)c1)C(=O)N1CCN(C(=O)c2cc3cc(Cl)ccc3[nH]2)CC1 |
| InChI | InChI=1S/C22H20Cl2N4O2/c23-16-3-1-2-14(10-16)11-18(25)21(29)27-6-8-28(9-7-27)22(30)20-13-15-12-17(24)4-5-19(15)26-20/h1-5,10-13,26H,6-9,25H2/b18-11- |
| InChIKey | WPJHLNBENXFLQE-WQRHYEAKSA-N |
| XLogP | 3.76 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|