C15H16ClN3O — CID 58646827
[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(5-chloro-1H-indol-2-yl)methanone (PubChem CID 58646827) has the molecular formula C15H16ClN3O and a molecular weight of 289.77 g/mol. Its IUPAC name is [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(5-chloro-1H-indol-2-yl)methanone.
| Compound Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(5-chloro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 58646827 |
| Molecular Formula | C15H16ClN3O |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(5-chloro-1H-indol-2-yl)methanone |
| SMILES | O=C(c1cc2cc(Cl)ccc2[nH]1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C15H16ClN3O/c16-12-1-2-13-9(3-12)4-14(18-13)15(20)19-7-10-5-17-6-11(10)8-19/h1-4,10-11,17-18H,5-8H2/t10-,11+ |
| InChIKey | MHMTXAAQGSUDGZ-PHIMTYICSA-N |
| XLogP | 2.11 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |