C23H25Cl2N3O — CID 171710459
[(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(5-chloro-1H-indol-2-yl)methanone;hydrochloride (PubChem CID 171710459) has the molecular formula C23H25Cl2N3O and a molecular weight of 430.38 g/mol. Its IUPAC name is [(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(5-chloro-1H-indol-2-yl)methanone;hydrochloride.
| Compound Name | [(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(5-chloro-1H-indol-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 171710459 |
| Molecular Formula | C23H25Cl2N3O |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | [(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(5-chloro-1H-indol-2-yl)methanone;hydrochloride |
| SMILES | Cc1ccccc1[C@@H]1[C@@H]2CN(C(=O)c3cc4cc(Cl)ccc4[nH]3)C[C@@H]2CN1C.Cl |
| InChI | InChI=1S/C23H24ClN3O.ClH/c1-14-5-3-4-6-18(14)22-19-13-27(12-16(19)11-26(22)2)23(28)21-10-15-9-17(24)7-8-20(15)25-21;/h3-10,16,19,22,25H,11-13H2,1-2H3;1H/t16-,19+,22+;/m0./s1 |
| InChIKey | HCDMUGKHTCFFSP-GWPNCTAKSA-N |
| XLogP | 4.93 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |