C20H27ClN4O — CID 171708572
[(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1-ethylpyrazol-3-yl)methanone;hydrochloride (PubChem CID 171708572) has the molecular formula C20H27ClN4O and a molecular weight of 374.92 g/mol. Its IUPAC name is [(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1-ethylpyrazol-3-yl)methanone;hydrochloride.
| Compound Name | [(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1-ethylpyrazol-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 171708572 |
| Molecular Formula | C20H27ClN4O |
| Molecular Weight | 374.92 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | [(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1-ethylpyrazol-3-yl)methanone;hydrochloride |
| SMILES | CCn1ccc(C(=O)N2C[C@@H]3CN(C)[C@H](c4ccccc4C)[C@@H]3C2)n1.Cl |
| InChI | InChI=1S/C20H26N4O.ClH/c1-4-24-10-9-18(21-24)20(25)23-12-15-11-22(3)19(17(15)13-23)16-8-6-5-7-14(16)2;/h5-10,15,17,19H,4,11-13H2,1-3H3;1H/t15-,17+,19+;/m0./s1 |
| InChIKey | PADVDDQAUKVDAY-JJVPLXBWSA-N |
| XLogP | 3.01 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.92 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |