C22H29Cl2N3O — CID 171330101
1-[(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(3-methyl-2-pyridinyl)ethanone;dihydrochloride (PubChem CID 171330101) has the molecular formula C22H29Cl2N3O and a molecular weight of 422.40 g/mol. Its IUPAC name is 1-[(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(3-methyl-2-pyridinyl)ethanone;dihydrochloride.
| Compound Name | 1-[(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(3-methyl-2-pyridinyl)ethanone;dihydrochloride |
|---|---|
| PubChem CID | 171330101 |
| Molecular Formula | C22H29Cl2N3O |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 1-[(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(3-methyl-2-pyridinyl)ethanone;dihydrochloride |
| SMILES | Cc1ccccc1[C@@H]1[C@@H]2CN(C(=O)Cc3ncccc3C)C[C@@H]2CN1C.Cl.Cl |
| InChI | InChI=1S/C22H27N3O.2ClH/c1-15-7-4-5-9-18(15)22-19-14-25(13-17(19)12-24(22)3)21(26)11-20-16(2)8-6-10-23-20;;/h4-10,17,19,22H,11-14H2,1-3H3;2*1H/t17-,19+,22+;;/m0../s1 |
| InChIKey | YGEXVXNAFOFCEP-ZJZMBGPLSA-N |
| XLogP | 3.85 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |