C16H18Cl3N3O — CID 126774460
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(7-chloroquinolin-2-yl)methanone;dihydrochloride (PubChem CID 126774460) has the molecular formula C16H18Cl3N3O and a molecular weight of 374.70 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(7-chloroquinolin-2-yl)methanone;dihydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(7-chloroquinolin-2-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 126774460 |
| Molecular Formula | C16H18Cl3N3O |
| Molecular Weight | 374.70 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(7-chloroquinolin-2-yl)methanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(c1ccc2ccc(Cl)cc2n1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C16H16ClN3O.2ClH/c17-13-3-1-10-2-4-14(19-15(10)5-13)16(21)20-8-11-6-18-7-12(11)9-20;;/h1-5,11-12,18H,6-9H2;2*1H/t11-,12+;; |
| InChIKey | WACWMYMRTKNEOD-FYPKGCJUSA-N |
| XLogP | 3.02 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.70 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |