C16H18Cl2N4O — CID 120660118
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[1-(3-chlorophenyl)pyrazol-3-yl]methanone;hydrochloride (PubChem CID 120660118) has the molecular formula C16H18Cl2N4O and a molecular weight of 353.25 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[1-(3-chlorophenyl)pyrazol-3-yl]methanone;hydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[1-(3-chlorophenyl)pyrazol-3-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120660118 |
| Molecular Formula | C16H18Cl2N4O |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[1-(3-chlorophenyl)pyrazol-3-yl]methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccn(-c2cccc(Cl)c2)n1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C16H17ClN4O.ClH/c17-13-2-1-3-14(6-13)21-5-4-15(19-21)16(22)20-9-11-7-18-8-12(11)10-20;/h1-6,11-12,18H,7-10H2;1H/t11-,12+; |
| InChIKey | JNTUIWFSJXUPHO-IWKKHLOMSA-N |
| XLogP | 2.24 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |