C27H24ClFN4O2 — CID 122421179
N-[3-[[4-(5-chloro-1H-indole-2-carbonyl)piperazin-1-yl]methyl]phenyl]-N-(4-fluorophenyl)formamide (PubChem CID 122421179) has the molecular formula C27H24ClFN4O2 and a molecular weight of 490.97 g/mol. Its IUPAC name is N-[3-[[4-(5-chloro-1H-indole-2-carbonyl)piperazin-1-yl]methyl]phenyl]-N-(4-fluorophenyl)formamide.
| Compound Name | N-[3-[[4-(5-chloro-1H-indole-2-carbonyl)piperazin-1-yl]methyl]phenyl]-N-(4-fluorophenyl)formamide |
|---|---|
| PubChem CID | 122421179 |
| Molecular Formula | C27H24ClFN4O2 |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | N-[3-[[4-(5-chloro-1H-indole-2-carbonyl)piperazin-1-yl]methyl]phenyl]-N-(4-fluorophenyl)formamide |
| SMILES | O=CN(c1ccc(F)cc1)c1cccc(CN2CCN(C(=O)c3cc4cc(Cl)ccc4[nH]3)CC2)c1 |
| InChI | InChI=1S/C27H24ClFN4O2/c28-21-4-9-25-20(15-21)16-26(30-25)27(35)32-12-10-31(11-13-32)17-19-2-1-3-24(14-19)33(18-34)23-7-5-22(29)6-8-23/h1-9,14-16,18,30H,10-13,17H2 |
| InChIKey | FEEFHSGNNMQSKP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|