C21H21ClFN3O — CID 122434958
(5-chloro-1H-indol-2-yl)-[4-[(2-fluoro-4-methylphenyl)methyl]piperazin-1-yl]methanone (PubChem CID 122434958) has the molecular formula C21H21ClFN3O and a molecular weight of 385.87 g/mol. Its IUPAC name is (5-chloro-1H-indol-2-yl)-[4-[(2-fluoro-4-methylphenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | (5-chloro-1H-indol-2-yl)-[4-[(2-fluoro-4-methylphenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122434958 |
| Molecular Formula | C21H21ClFN3O |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | (5-chloro-1H-indol-2-yl)-[4-[(2-fluoro-4-methylphenyl)methyl]piperazin-1-yl]methanone |
| SMILES | Cc1ccc(CN2CCN(C(=O)c3cc4cc(Cl)ccc4[nH]3)CC2)c(F)c1 |
| InChI | InChI=1S/C21H21ClFN3O/c1-14-2-3-15(18(23)10-14)13-25-6-8-26(9-7-25)21(27)20-12-16-11-17(22)4-5-19(16)24-20/h2-5,10-12,24H,6-9,13H2,1H3 |
| InChIKey | QGYSWVBHNJDBNM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |