About 6-chloro-3-(hydroxymethyl)-1H-quinolin-2-one;ethane;methane
6-chloro-3-(hydroxymethyl)-1H-quinolin-2-one;ethane;methane (PubChem CID 170632349) has the molecular formula C13H18ClNO2
and a molecular weight of 255.75 g/mol. Its IUPAC name is 6-chloro-3-(hydroxymethyl)-1H-quinolin-2-one;ethane;methane.
Molecular Properties
| Compound Name | 6-chloro-3-(hydroxymethyl)-1H-quinolin-2-one;ethane;methane |
| PubChem CID | 170632349 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 6-chloro-3-(hydroxymethyl)-1H-quinolin-2-one;ethane;methane |
| SMILES | C.CC.O=c1[nH]c2ccc(Cl)cc2cc1CO |
| InChI | InChI=1S/C10H8ClNO2.C2H6.CH4/c11-8-1-2-9-6(4-8)3-7(5-13)10(14)12-9;1-2;/h1-4,13H,5H2,(H,12,14);1-2H3;1H4 |
| InChIKey | QXQYPRAYNGLUMN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-3-(hydroxymethyl)-1H-quinolin-2-one;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-(hydroxymethyl)-1H-quinolin-2-one;ethane;methane?
The IUPAC name of 6-chloro-3-(hydroxymethyl)-1H-quinolin-2-one;ethane;methane (CID 170632349) is 6-chloro-3-(hydroxymethyl)-1H-quinolin-2-one;ethane;methane.
What is the SMILES notation for 6-chloro-3-(hydroxymethyl)-1H-quinolin-2-one;ethane;methane?
The canonical SMILES for 6-chloro-3-(hydroxymethyl)-1H-quinolin-2-one;ethane;methane is C.CC.O=c1[nH]c2ccc(Cl)cc2cc1CO.
What is the InChIKey of 6-chloro-3-(hydroxymethyl)-1H-quinolin-2-one;ethane;methane?
The InChIKey is QXQYPRAYNGLUMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClNO2.C2H6.CH4/c11-8-1-2-9-6(4-8)3-7(5-13)10(14)12-9;1-2;/h1-4,13H,5H2,(H,12,14);1-2H3;1H4.
What are the key properties of 6-chloro-3-(hydroxymethyl)-1H-quinolin-2-one;ethane;methane?
6-chloro-3-(hydroxymethyl)-1H-quinolin-2-one;ethane;methane has a molecular weight of 255.75 g/mol, XLogP of 3.34, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-(hydroxymethyl)-1H-quinolin-2-one;ethane;methane is sourced from PubChem (CID 170632349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).