C10H6ClNO2 — CID 175535204
7-chloro-1H-1-benzazepine-2,3-dione (PubChem CID 175535204) has the molecular formula C10H6ClNO2 and a molecular weight of 207.62 g/mol. Its IUPAC name is 7-chloro-1H-1-benzazepine-2,3-dione.
| Compound Name | 7-chloro-1H-1-benzazepine-2,3-dione |
|---|---|
| PubChem CID | 175535204 |
| Molecular Formula | C10H6ClNO2 |
| Molecular Weight | 207.62 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | 7-chloro-1H-1-benzazepine-2,3-dione |
| SMILES | O=c1ccc2cc(Cl)ccc2[nH]c1=O |
| InChI | InChI=1S/C10H6ClNO2/c11-7-2-3-8-6(5-7)1-4-9(13)10(14)12-8/h1-5H,(H,12,13,14) |
| InChIKey | OZMVJNRAMIZPHN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.62 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|