C9H7ClNO4P — CID 10945159
(7-chloro-2-oxo-1H-quinolin-3-yl)phosphonic acid (PubChem CID 10945159) has the molecular formula C9H7ClNO4P and a molecular weight of 259.59 g/mol. Its IUPAC name is (7-chloro-2-oxo-1H-quinolin-3-yl)phosphonic acid.
| Compound Name | (7-chloro-2-oxo-1H-quinolin-3-yl)phosphonic acid |
|---|---|
| PubChem CID | 10945159 |
| Molecular Formula | C9H7ClNO4P |
| Molecular Weight | 259.59 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | (7-chloro-2-oxo-1H-quinolin-3-yl)phosphonic acid |
| SMILES | O=c1[nH]c2cc(Cl)ccc2cc1P(=O)(O)O |
| InChI | InChI=1S/C9H7ClNO4P/c10-6-2-1-5-3-8(16(13,14)15)9(12)11-7(5)4-6/h1-4H,(H,11,12)(H2,13,14,15) |
| InChIKey | BYJQKPBFCDIIFS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.59 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|