C18H23ClN2O3 — CID 142970241
7-chloro-N-(1-methylcyclopentyl)-2-oxo-1H-quinoline-3-carboxamide;methoxymethane (PubChem CID 142970241) has the molecular formula C18H23ClN2O3 and a molecular weight of 350.85 g/mol. Its IUPAC name is 7-chloro-N-(1-methylcyclopentyl)-2-oxo-1H-quinoline-3-carboxamide;methoxymethane.
| Compound Name | 7-chloro-N-(1-methylcyclopentyl)-2-oxo-1H-quinoline-3-carboxamide;methoxymethane |
|---|---|
| PubChem CID | 142970241 |
| Molecular Formula | C18H23ClN2O3 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 7-chloro-N-(1-methylcyclopentyl)-2-oxo-1H-quinoline-3-carboxamide;methoxymethane |
| SMILES | CC1(NC(=O)c2cc3ccc(Cl)cc3[nH]c2=O)CCCC1.COC |
| InChI | InChI=1S/C16H17ClN2O2.C2H6O/c1-16(6-2-3-7-16)19-15(21)12-8-10-4-5-11(17)9-13(10)18-14(12)20;1-3-2/h4-5,8-9H,2-3,6-7H2,1H3,(H,18,20)(H,19,21);1-2H3 |
| InChIKey | ZBSAMJJOZVIDTC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |