C14H15ClN2O — CID 84639003
6-chloro-3-(pyrrolidin-3-ylmethyl)-1H-quinolin-2-one (PubChem CID 84639003) has the molecular formula C14H15ClN2O and a molecular weight of 262.74 g/mol. Its IUPAC name is 6-chloro-3-(pyrrolidin-3-ylmethyl)-1H-quinolin-2-one.
| Compound Name | 6-chloro-3-(pyrrolidin-3-ylmethyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 84639003 |
| Molecular Formula | C14H15ClN2O |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 6-chloro-3-(pyrrolidin-3-ylmethyl)-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccc(Cl)cc2cc1CC1CCNC1 |
| InChI | InChI=1S/C14H15ClN2O/c15-12-1-2-13-10(7-12)6-11(14(18)17-13)5-9-3-4-16-8-9/h1-2,6-7,9,16H,3-5,8H2,(H,17,18) |
| InChIKey | YPVMWVARCHEOGP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |