C13H12INO — CID 67032964
3-(cyclopropylmethyl)-7-iodo-1H-quinolin-2-one (PubChem CID 67032964) has the molecular formula C13H12INO and a molecular weight of 325.15 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-7-iodo-1H-quinolin-2-one.
| Compound Name | 3-(cyclopropylmethyl)-7-iodo-1H-quinolin-2-one |
|---|---|
| PubChem CID | 67032964 |
| Molecular Formula | C13H12INO |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | 3-(cyclopropylmethyl)-7-iodo-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2cc(I)ccc2cc1CC1CC1 |
| InChI | InChI=1S/C13H12INO/c14-11-4-3-9-6-10(5-8-1-2-8)13(16)15-12(9)7-11/h3-4,6-8H,1-2,5H2,(H,15,16) |
| InChIKey | DZMLENHZSBBUQV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|