C19H22N2O — CID 56748014
3-[[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]methyl]-7-methyl-1H-quinolin-2-one (PubChem CID 56748014) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 3-[[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]methyl]-7-methyl-1H-quinolin-2-one.
| Compound Name | 3-[[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]methyl]-7-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 56748014 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 3-[[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]methyl]-7-methyl-1H-quinolin-2-one |
| SMILES | Cc1ccc2cc(CN3C[C@H]4CC=CC[C@H]4C3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C19H22N2O/c1-13-6-7-14-9-17(19(22)20-18(14)8-13)12-21-10-15-4-2-3-5-16(15)11-21/h2-3,6-9,15-16H,4-5,10-12H2,1H3,(H,20,22)/t15-,16+ |
| InChIKey | AARQVCFRNHAZFB-IYBDPMFKSA-N |
| XLogP | 3.23 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|