C19H25N3O2 — CID 56709700
N-[[1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]piperidin-3-yl]methyl]acetamide (PubChem CID 56709700) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[[1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]piperidin-3-yl]methyl]acetamide.
| Compound Name | N-[[1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]piperidin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 56709700 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | N-[[1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]piperidin-3-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CCCN(Cc2cc3ccc(C)cc3[nH]c2=O)C1 |
| InChI | InChI=1S/C19H25N3O2/c1-13-5-6-16-9-17(19(24)21-18(16)8-13)12-22-7-3-4-15(11-22)10-20-14(2)23/h5-6,8-9,15H,3-4,7,10-12H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | OPQIUZZJCJLXCE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |