C19H26N4O2 — CID 95198920
1-ethyl-3-[[(3S)-1-[(2-oxo-1H-quinolin-3-yl)methyl]piperidin-3-yl]methyl]urea (PubChem CID 95198920) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-ethyl-3-[[(3S)-1-[(2-oxo-1H-quinolin-3-yl)methyl]piperidin-3-yl]methyl]urea.
| Compound Name | 1-ethyl-3-[[(3S)-1-[(2-oxo-1H-quinolin-3-yl)methyl]piperidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 95198920 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 1-ethyl-3-[[(3S)-1-[(2-oxo-1H-quinolin-3-yl)methyl]piperidin-3-yl]methyl]urea |
| SMILES | CCNC(=O)NC[C@@H]1CCCN(Cc2cc3ccccc3[nH]c2=O)C1 |
| InChI | InChI=1S/C19H26N4O2/c1-2-20-19(25)21-11-14-6-5-9-23(12-14)13-16-10-15-7-3-4-8-17(15)22-18(16)24/h3-4,7-8,10,14H,2,5-6,9,11-13H2,1H3,(H,22,24)(H2,20,21,25)/t14-/m0/s1 |
| InChIKey | RBKWCISLNZIWBX-AWEZNQCLSA-N |
| XLogP | 2.06 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |