C22H27N5O3 — CID 129324681
N-(2-methoxyethyl)-5-[(3R)-1-[(2-oxo-1H-quinolin-3-yl)methyl]piperidin-3-yl]-1H-pyrazole-4-carboxamide (PubChem CID 129324681) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-[(3R)-1-[(2-oxo-1H-quinolin-3-yl)methyl]piperidin-3-yl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-(2-methoxyethyl)-5-[(3R)-1-[(2-oxo-1H-quinolin-3-yl)methyl]piperidin-3-yl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 129324681 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | N-(2-methoxyethyl)-5-[(3R)-1-[(2-oxo-1H-quinolin-3-yl)methyl]piperidin-3-yl]-1H-pyrazole-4-carboxamide |
| SMILES | COCCNC(=O)c1cn[nH]c1[C@@H]1CCCN(Cc2cc3ccccc3[nH]c2=O)C1 |
| InChI | InChI=1S/C22H27N5O3/c1-30-10-8-23-22(29)18-12-24-26-20(18)16-6-4-9-27(13-16)14-17-11-15-5-2-3-7-19(15)25-21(17)28/h2-3,5,7,11-12,16H,4,6,8-10,13-14H2,1H3,(H,23,29)(H,24,26)(H,25,28)/t16-/m1/s1 |
| InChIKey | QLCSWLWGJHODKV-MRXNPFEDSA-N |
| XLogP | 2.01 |
| TPSA | 103.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|