C20H25N5O5 — CID 129324417
(3R)-N-(1,3-benzodioxol-5-yl)-3-[4-(2-methoxyethylcarbamoyl)-1H-pyrazol-5-yl]piperidine-1-carboxamide (PubChem CID 129324417) has the molecular formula C20H25N5O5 and a molecular weight of 415.45 g/mol. Its IUPAC name is (3R)-N-(1,3-benzodioxol-5-yl)-3-[4-(2-methoxyethylcarbamoyl)-1H-pyrazol-5-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-N-(1,3-benzodioxol-5-yl)-3-[4-(2-methoxyethylcarbamoyl)-1H-pyrazol-5-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 129324417 |
| Molecular Formula | C20H25N5O5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | (3R)-N-(1,3-benzodioxol-5-yl)-3-[4-(2-methoxyethylcarbamoyl)-1H-pyrazol-5-yl]piperidine-1-carboxamide |
| SMILES | COCCNC(=O)c1cn[nH]c1[C@@H]1CCCN(C(=O)Nc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C20H25N5O5/c1-28-8-6-21-19(26)15-10-22-24-18(15)13-3-2-7-25(11-13)20(27)23-14-4-5-16-17(9-14)30-12-29-16/h4-5,9-10,13H,2-3,6-8,11-12H2,1H3,(H,21,26)(H,22,24)(H,23,27)/t13-/m1/s1 |
| InChIKey | MLDOEVOZMKOMBV-CYBMUJFWSA-N |
| XLogP | 1.93 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|