C21H25N5O6S — CID 92871595
N-(1,3-benzodioxol-5-yl)-5-[(3S)-3-(3-methoxypropylcarbamoyl)piperidine-1-carbonyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 92871595) has the molecular formula C21H25N5O6S and a molecular weight of 475.53 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-[(3S)-3-(3-methoxypropylcarbamoyl)piperidine-1-carbonyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-[(3S)-3-(3-methoxypropylcarbamoyl)piperidine-1-carbonyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 92871595 |
| Molecular Formula | C21H25N5O6S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-[(3S)-3-(3-methoxypropylcarbamoyl)piperidine-1-carbonyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | COCCCNC(=O)[C@H]1CCCN(C(=O)c2nnc(C(=O)Nc3ccc4c(c3)OCO4)s2)C1 |
| InChI | InChI=1S/C21H25N5O6S/c1-30-9-3-7-22-17(27)13-4-2-8-26(11-13)21(29)20-25-24-19(33-20)18(28)23-14-5-6-15-16(10-14)32-12-31-15/h5-6,10,13H,2-4,7-9,11-12H2,1H3,(H,22,27)(H,23,28)/t13-/m0/s1 |
| InChIKey | ZPOOTRIXCMXBMS-ZDUSSCGKSA-N |
| XLogP | 1.52 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|