C20H24ClN5O3S — CID 92890851
5-[(3R)-3-(butylcarbamoyl)piperidine-1-carbonyl]-N-(4-chlorophenyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 92890851) has the molecular formula C20H24ClN5O3S and a molecular weight of 449.96 g/mol. Its IUPAC name is 5-[(3R)-3-(butylcarbamoyl)piperidine-1-carbonyl]-N-(4-chlorophenyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-[(3R)-3-(butylcarbamoyl)piperidine-1-carbonyl]-N-(4-chlorophenyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 92890851 |
| Molecular Formula | C20H24ClN5O3S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 5-[(3R)-3-(butylcarbamoyl)piperidine-1-carbonyl]-N-(4-chlorophenyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCCCNC(=O)[C@@H]1CCCN(C(=O)c2nnc(C(=O)Nc3ccc(Cl)cc3)s2)C1 |
| InChI | InChI=1S/C20H24ClN5O3S/c1-2-3-10-22-16(27)13-5-4-11-26(12-13)20(29)19-25-24-18(30-19)17(28)23-15-8-6-14(21)7-9-15/h6-9,13H,2-5,10-12H2,1H3,(H,22,27)(H,23,28)/t13-/m1/s1 |
| InChIKey | JGQPMTUOSVJBLI-CYBMUJFWSA-N |
| XLogP | 3.21 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|